C20H35NO7 — CID 142059000
ditert-butyl (2R,4R,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 142059000) has the molecular formula C20H35NO7 and a molecular weight of 401.50 g/mol. Its IUPAC name is ditert-butyl (2R,4R,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R,4R,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142059000 |
| Molecular Formula | C20H35NO7 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | ditert-butyl (2R,4R,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1C[C@@H](CO)[C@H](C2COC(C)(C)O2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H35NO7/c1-18(2,3)27-16(23)13-9-12(10-22)15(14-11-25-20(7,8)26-14)21(13)17(24)28-19(4,5)6/h12-15,22H,9-11H2,1-8H3/t12-,13+,14?,15+/m0/s1 |
| InChIKey | HMQFHIBDFVCQFW-MCBWDKPDSA-N |
| XLogP | 2.47 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |