C17H29NO6 — CID 57019415
ditert-butyl (4R,5R)-4-(hydroxymethyl)-5-(oxiran-2-yl)pyrrolidine-1,2-dicarboxylate (PubChem CID 57019415) has the molecular formula C17H29NO6 and a molecular weight of 343.42 g/mol. Its IUPAC name is ditert-butyl (4R,5R)-4-(hydroxymethyl)-5-(oxiran-2-yl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (4R,5R)-4-(hydroxymethyl)-5-(oxiran-2-yl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 57019415 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | ditert-butyl (4R,5R)-4-(hydroxymethyl)-5-(oxiran-2-yl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1C[C@@H](CO)[C@H](C2CO2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO6/c1-16(2,3)23-14(20)11-7-10(8-19)13(12-9-22-12)18(11)15(21)24-17(4,5)6/h10-13,19H,7-9H2,1-6H3/t10-,11?,12?,13+/m0/s1 |
| InChIKey | OVBOTFKUMJEDIQ-YWPUVAFDSA-N |
| XLogP | 1.71 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|