C28H40NO5P — CID 142061351
butyl (3S)-3-formyl-4-(4-phenylphenyl)butanoate;ethane;(4S)-3-methyl-4-(phosphanylmethyl)-1,3-oxazolidin-2-one (PubChem CID 142061351) has the molecular formula C28H40NO5P and a molecular weight of 501.60 g/mol. Its IUPAC name is butyl (3S)-3-formyl-4-(4-phenylphenyl)butanoate;ethane;(4S)-3-methyl-4-(phosphanylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | butyl (3S)-3-formyl-4-(4-phenylphenyl)butanoate;ethane;(4S)-3-methyl-4-(phosphanylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142061351 |
| Molecular Formula | C28H40NO5P |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | butyl (3S)-3-formyl-4-(4-phenylphenyl)butanoate;ethane;(4S)-3-methyl-4-(phosphanylmethyl)-1,3-oxazolidin-2-one |
| SMILES | CC.CCCCOC(=O)C[C@@H](C=O)Cc1ccc(-c2ccccc2)cc1.CN1C(=O)OC[C@H]1CP |
| InChI | InChI=1S/C21H24O3.C5H10NO2P.C2H6/c1-2-3-13-24-21(23)15-18(16-22)14-17-9-11-20(12-10-17)19-7-5-4-6-8-19;1-6-4(3-9)2-8-5(6)7;1-2/h4-12,16,18H,2-3,13-15H2,1H3;4H,2-3,9H2,1H3;1-2H3/t18-;4-;/m00./s1 |
| InChIKey | ZHTJJFKLYJWLGR-HHHXVULZSA-N |
| XLogP | 5.78 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|