About 2-butan-2-ylthiolane;ethane;propane
2-butan-2-ylthiolane;ethane;propane (PubChem CID 142062974) has the molecular formula C15H36S
and a molecular weight of 248.52 g/mol. Its IUPAC name is 2-butan-2-ylthiolane;ethane;propane.
Molecular Properties
| Compound Name | 2-butan-2-ylthiolane;ethane;propane |
| PubChem CID | 142062974 |
| Molecular Formula | C15H36S |
| Molecular Weight | 248.52 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | 2-butan-2-ylthiolane;ethane;propane |
| SMILES | CC.CC.CCC.CCC(C)C1CCCS1 |
| InChI | InChI=1S/C8H16S.C3H8.2C2H6/c1-3-7(2)8-5-4-6-9-8;1-3-2;2*1-2/h7-8H,3-6H2,1-2H3;3H2,1-2H3;2*1-2H3 |
| InChIKey | OLADKZFYCRLJOO-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.52 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butan-2-ylthiolane;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-ylthiolane;ethane;propane?
The IUPAC name of 2-butan-2-ylthiolane;ethane;propane (CID 142062974) is 2-butan-2-ylthiolane;ethane;propane.
What is the SMILES notation for 2-butan-2-ylthiolane;ethane;propane?
The canonical SMILES for 2-butan-2-ylthiolane;ethane;propane is CC.CC.CCC.CCC(C)C1CCCS1.
What is the InChIKey of 2-butan-2-ylthiolane;ethane;propane?
The InChIKey is OLADKZFYCRLJOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16S.C3H8.2C2H6/c1-3-7(2)8-5-4-6-9-8;1-3-2;2*1-2/h7-8H,3-6H2,1-2H3;3H2,1-2H3;2*1-2H3.
What are the key properties of 2-butan-2-ylthiolane;ethane;propane?
2-butan-2-ylthiolane;ethane;propane has a molecular weight of 248.52 g/mol, XLogP of 6.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-ylthiolane;ethane;propane is sourced from PubChem (CID 142062974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).