About 2-octan-4-ylthiolane
2-octan-4-ylthiolane (PubChem CID 163811177) has the molecular formula C12H24S
and a molecular weight of 200.39 g/mol. Its IUPAC name is 2-octan-4-ylthiolane.
Molecular Properties
| Compound Name | 2-octan-4-ylthiolane |
| PubChem CID | 163811177 |
| Molecular Formula | C12H24S |
| Molecular Weight | 200.39 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-octan-4-ylthiolane |
| SMILES | CCCCC(CCC)C1CCCS1 |
| InChI | InChI=1S/C12H24S/c1-3-5-8-11(7-4-2)12-9-6-10-13-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | NNJPAJPPMTZTSM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-octan-4-ylthiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octan-4-ylthiolane?
The IUPAC name of 2-octan-4-ylthiolane (CID 163811177) is 2-octan-4-ylthiolane.
What is the SMILES notation for 2-octan-4-ylthiolane?
The canonical SMILES for 2-octan-4-ylthiolane is CCCCC(CCC)C1CCCS1.
What is the InChIKey of 2-octan-4-ylthiolane?
The InChIKey is NNJPAJPPMTZTSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24S/c1-3-5-8-11(7-4-2)12-9-6-10-13-12/h11-12H,3-10H2,1-2H3.
What are the key properties of 2-octan-4-ylthiolane?
2-octan-4-ylthiolane has a molecular weight of 200.39 g/mol, XLogP of 4.49, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octan-4-ylthiolane is sourced from PubChem (CID 163811177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).