C17H29N — CID 142064689
4-(3,3,6,6-tetramethyloctan-4-yl)pyridine (PubChem CID 142064689) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 4-(3,3,6,6-tetramethyloctan-4-yl)pyridine.
| Compound Name | 4-(3,3,6,6-tetramethyloctan-4-yl)pyridine |
|---|---|
| PubChem CID | 142064689 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 4-(3,3,6,6-tetramethyloctan-4-yl)pyridine |
| SMILES | CCC(C)(C)CC(c1ccncc1)C(C)(C)CC |
| InChI | InChI=1S/C17H29N/c1-7-16(3,4)13-15(17(5,6)8-2)14-9-11-18-12-10-14/h9-12,15H,7-8,13H2,1-6H3 |
| InChIKey | HHLIVWFJXJXWMY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |