C18H21NO — CID 142064777
ethane;2-[6-(1-hydroxyethenyl)-5,8-dimethylnaphthalen-1-yl]acetonitrile (PubChem CID 142064777) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is ethane;2-[6-(1-hydroxyethenyl)-5,8-dimethylnaphthalen-1-yl]acetonitrile.
| Compound Name | ethane;2-[6-(1-hydroxyethenyl)-5,8-dimethylnaphthalen-1-yl]acetonitrile |
|---|---|
| PubChem CID | 142064777 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | ethane;2-[6-(1-hydroxyethenyl)-5,8-dimethylnaphthalen-1-yl]acetonitrile |
| SMILES | C=C(O)c1cc(C)c2c(CC#N)cccc2c1C.CC |
| InChI | InChI=1S/C16H15NO.C2H6/c1-10-9-15(12(3)18)11(2)14-6-4-5-13(7-8-17)16(10)14;1-2/h4-6,9,18H,3,7H2,1-2H3;1-2H3 |
| InChIKey | QCQKYYYEVBUFHT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|