About ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one
ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one (PubChem CID 169248948) has the molecular formula C22H29NO
and a molecular weight of 323.48 g/mol. Its IUPAC name is ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one.
Molecular Properties
| Compound Name | ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one |
| PubChem CID | 169248948 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one |
| SMILES | CC.CCCC(=O)c1cccc(C)c1.Cc1ccccc1CC#N |
| InChI | InChI=1S/C11H14O.C9H9N.C2H6/c1-3-5-11(12)10-7-4-6-9(2)8-10;1-8-4-2-3-5-9(8)6-7-10;1-2/h4,6-8H,3,5H2,1-2H3;2-5H,6H2,1H3;1-2H3 |
| InChIKey | NJVUMCKYSYVCIM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one?
The IUPAC name of ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one (CID 169248948) is ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one.
What is the SMILES notation for ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one?
The canonical SMILES for ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one is CC.CCCC(=O)c1cccc(C)c1.Cc1ccccc1CC#N.
What is the InChIKey of ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one?
The InChIKey is NJVUMCKYSYVCIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O.C9H9N.C2H6/c1-3-5-11(12)10-7-4-6-9(2)8-10;1-8-4-2-3-5-9(8)6-7-10;1-2/h4,6-8H,3,5H2,1-2H3;2-5H,6H2,1H3;1-2H3.
What are the key properties of ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one?
ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one has a molecular weight of 323.48 g/mol, XLogP of 6.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2-methylphenyl)acetonitrile;1-(3-methylphenyl)butan-1-one is sourced from PubChem (CID 169248948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).