C31H34F4N6O5 — CID 142065715
(3S,5S)-5-[[4-[2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propan-2-yl]piperazin-1-yl]methyl]-3-(furo[2,3-d]pyrimidin-6-ylmethyl)oxolan-2-one;N-(2,2,2-trifluoroethyl)formamide (PubChem CID 142065715) has the molecular formula C31H34F4N6O5 and a molecular weight of 646.64 g/mol. Its IUPAC name is (3S,5S)-5-[[4-[2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propan-2-yl]piperazin-1-yl]methyl]-3-(furo[2,3-d]pyrimidin-6-ylmethyl)oxolan-2-one;N-(2,2,2-trifluoroethyl)formamide.
| Compound Name | (3S,5S)-5-[[4-[2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propan-2-yl]piperazin-1-yl]methyl]-3-(furo[2,3-d]pyrimidin-6-ylmethyl)oxolan-2-one;N-(2,2,2-trifluoroethyl)formamide |
|---|---|
| PubChem CID | 142065715 |
| Molecular Formula | C31H34F4N6O5 |
| Molecular Weight | 646.64 g/mol |
| Exact Mass | 646.25 |
| IUPAC Name | (3S,5S)-5-[[4-[2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propan-2-yl]piperazin-1-yl]methyl]-3-(furo[2,3-d]pyrimidin-6-ylmethyl)oxolan-2-one;N-(2,2,2-trifluoroethyl)formamide |
| SMILES | CC(C)(c1ncc(-c2ccc(F)cc2)o1)N1CCN(C[C@@H]2C[C@@H](Cc3cc4cncnc4o3)C(=O)O2)CC1.O=CNCC(F)(F)F |
| InChI | InChI=1S/C28H30FN5O4.C3H4F3NO/c1-28(2,27-31-15-24(38-27)18-3-5-21(29)6-4-18)34-9-7-33(8-10-34)16-23-12-19(26(35)37-23)11-22-13-20-14-30-17-32-25(20)36-22;4-3(5,6)1-7-2-8/h3-6,13-15,17,19,23H,7-12,16H2,1-2H3;2H,1H2,(H,7,8)/t19-,23+;/m1./s1 |
| InChIKey | NVJWIJIWBPRIEQ-GZAZMHIXSA-N |
| XLogP | 4.34 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|