C16H32N2 — CID 142067893
2-[1-[(2S)-2,5-dimethylhex-4-enyl]pyrrolidin-2-yl]-N,N-dimethylethanamine (PubChem CID 142067893) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 2-[1-[(2S)-2,5-dimethylhex-4-enyl]pyrrolidin-2-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[1-[(2S)-2,5-dimethylhex-4-enyl]pyrrolidin-2-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 142067893 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 2-[1-[(2S)-2,5-dimethylhex-4-enyl]pyrrolidin-2-yl]-N,N-dimethylethanamine |
| SMILES | CC(C)=CC[C@H](C)CN1CCCC1CCN(C)C |
| InChI | InChI=1S/C16H32N2/c1-14(2)8-9-15(3)13-18-11-6-7-16(18)10-12-17(4)5/h8,15-16H,6-7,9-13H2,1-5H3/t15-,16?/m0/s1 |
| InChIKey | IVAUGXSFVJWENB-VYRBHSGPSA-N |
| XLogP | 3.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|