C20H28O2S — CID 142068388
ethane;4-[(2S)-2-(4-methoxyphenyl)-2-methylbutyl]-3-sulfanylphenol (PubChem CID 142068388) has the molecular formula C20H28O2S and a molecular weight of 332.51 g/mol. Its IUPAC name is ethane;4-[(2S)-2-(4-methoxyphenyl)-2-methylbutyl]-3-sulfanylphenol.
| Compound Name | ethane;4-[(2S)-2-(4-methoxyphenyl)-2-methylbutyl]-3-sulfanylphenol |
|---|---|
| PubChem CID | 142068388 |
| Molecular Formula | C20H28O2S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | ethane;4-[(2S)-2-(4-methoxyphenyl)-2-methylbutyl]-3-sulfanylphenol |
| SMILES | CC.CC[C@@](C)(Cc1ccc(O)cc1S)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H22O2S.C2H6/c1-4-18(2,14-6-9-16(20-3)10-7-14)12-13-5-8-15(19)11-17(13)21;1-2/h5-11,19,21H,4,12H2,1-3H3;1-2H3/t18-;/m0./s1 |
| InChIKey | CAZOLKOJJXHRRP-FERBBOLQSA-N |
| XLogP | 5.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|