C16H20O — CID 172584757
6-(3-methylpentan-3-yl)naphthalen-2-ol (PubChem CID 172584757) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is 6-(3-methylpentan-3-yl)naphthalen-2-ol.
| Compound Name | 6-(3-methylpentan-3-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 172584757 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 6-(3-methylpentan-3-yl)naphthalen-2-ol |
| SMILES | CCC(C)(CC)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C16H20O/c1-4-16(3,5-2)14-8-6-13-11-15(17)9-7-12(13)10-14/h6-11,17H,4-5H2,1-3H3 |
| InChIKey | CGHGQYVQTRLGMG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |