C16H20O — CID 130432101
7-(2,3-dimethylbutan-2-yl)naphthalen-2-ol (PubChem CID 130432101) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is 7-(2,3-dimethylbutan-2-yl)naphthalen-2-ol.
| Compound Name | 7-(2,3-dimethylbutan-2-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 130432101 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 7-(2,3-dimethylbutan-2-yl)naphthalen-2-ol |
| SMILES | CC(C)C(C)(C)c1ccc2ccc(O)cc2c1 |
| InChI | InChI=1S/C16H20O/c1-11(2)16(3,4)14-7-5-12-6-8-15(17)10-13(12)9-14/h5-11,17H,1-4H3 |
| InChIKey | WXDDSBHKIGORTR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |