C16H20N2OS2 — CID 142069141
4-ethyl-N-(1-thiophen-2-ylprop-2-ynyl)-1,3-thiazole-5-carboxamide;propane (PubChem CID 142069141) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 4-ethyl-N-(1-thiophen-2-ylprop-2-ynyl)-1,3-thiazole-5-carboxamide;propane.
| Compound Name | 4-ethyl-N-(1-thiophen-2-ylprop-2-ynyl)-1,3-thiazole-5-carboxamide;propane |
|---|---|
| PubChem CID | 142069141 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 4-ethyl-N-(1-thiophen-2-ylprop-2-ynyl)-1,3-thiazole-5-carboxamide;propane |
| SMILES | C#CC(NC(=O)c1scnc1CC)c1cccs1.CCC |
| InChI | InChI=1S/C13H12N2OS2.C3H8/c1-3-9(11-6-5-7-17-11)15-13(16)12-10(4-2)14-8-18-12;1-3-2/h1,5-9H,4H2,2H3,(H,15,16);3H2,1-2H3 |
| InChIKey | IHDSQZLDZULFNX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|