C16H19F3N2S — CID 142070571
2-(2-ethylbutyl)-1-sulfanyl-4-[3-(trifluoromethyl)phenyl]imidazole (PubChem CID 142070571) has the molecular formula C16H19F3N2S and a molecular weight of 328.40 g/mol. Its IUPAC name is 2-(2-ethylbutyl)-1-sulfanyl-4-[3-(trifluoromethyl)phenyl]imidazole.
| Compound Name | 2-(2-ethylbutyl)-1-sulfanyl-4-[3-(trifluoromethyl)phenyl]imidazole |
|---|---|
| PubChem CID | 142070571 |
| Molecular Formula | C16H19F3N2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-(2-ethylbutyl)-1-sulfanyl-4-[3-(trifluoromethyl)phenyl]imidazole |
| SMILES | CCC(CC)Cc1nc(-c2cccc(C(F)(F)F)c2)cn1S |
| InChI | InChI=1S/C16H19F3N2S/c1-3-11(4-2)8-15-20-14(10-21(15)22)12-6-5-7-13(9-12)16(17,18)19/h5-7,9-11,22H,3-4,8H2,1-2H3 |
| InChIKey | HKYKYWAXMSRHRO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|