C21H36O2 — CID 142071430
ethyl (6Z,12Z,15Z)-9-methyloctadeca-6,12,15-trienoate (PubChem CID 142071430) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is ethyl (6Z,12Z,15Z)-9-methyloctadeca-6,12,15-trienoate.
| Compound Name | ethyl (6Z,12Z,15Z)-9-methyloctadeca-6,12,15-trienoate |
|---|---|
| PubChem CID | 142071430 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | ethyl (6Z,12Z,15Z)-9-methyloctadeca-6,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\CCC(C)C/C=C\CCCCC(=O)OCC |
| InChI | InChI=1S/C21H36O2/c1-4-6-7-8-9-11-14-17-20(3)18-15-12-10-13-16-19-21(22)23-5-2/h6-7,9,11-12,15,20H,4-5,8,10,13-14,16-19H2,1-3H3/b7-6-,11-9-,15-12- |
| InChIKey | HKOASDHCVQDESO-DKJNNILBSA-N |
| XLogP | 6.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|