C29H33NO7S — CID 142071930
1-(1-benzofuran-4-yloxy)-3-[4-(6-methoxy-1-benzothiophen-2-yl)-2-methylpiperidin-1-yl]propan-2-ol;2-hydroxyprop-2-enoic acid (PubChem CID 142071930) has the molecular formula C29H33NO7S and a molecular weight of 539.65 g/mol. Its IUPAC name is 1-(1-benzofuran-4-yloxy)-3-[4-(6-methoxy-1-benzothiophen-2-yl)-2-methylpiperidin-1-yl]propan-2-ol;2-hydroxyprop-2-enoic acid.
| Compound Name | 1-(1-benzofuran-4-yloxy)-3-[4-(6-methoxy-1-benzothiophen-2-yl)-2-methylpiperidin-1-yl]propan-2-ol;2-hydroxyprop-2-enoic acid |
|---|---|
| PubChem CID | 142071930 |
| Molecular Formula | C29H33NO7S |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 1-(1-benzofuran-4-yloxy)-3-[4-(6-methoxy-1-benzothiophen-2-yl)-2-methylpiperidin-1-yl]propan-2-ol;2-hydroxyprop-2-enoic acid |
| SMILES | C=C(O)C(=O)O.COc1ccc2cc(C3CCN(CC(O)COc4cccc5occc45)C(C)C3)sc2c1 |
| InChI | InChI=1S/C26H29NO4S.C3H4O3/c1-17-12-19(25-13-18-6-7-21(29-2)14-26(18)32-25)8-10-27(17)15-20(28)16-31-24-5-3-4-23-22(24)9-11-30-23;1-2(4)3(5)6/h3-7,9,11,13-14,17,19-20,28H,8,10,12,15-16H2,1-2H3;4H,1H2,(H,5,6) |
| InChIKey | IUBKMSFHIXFWJE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|