C13H20N2 — CID 142072078
3,7-dimethyl-2,7-dihydro-1H-cyclohepta[b]pyrazine;ethane (PubChem CID 142072078) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 3,7-dimethyl-2,7-dihydro-1H-cyclohepta[b]pyrazine;ethane.
| Compound Name | 3,7-dimethyl-2,7-dihydro-1H-cyclohepta[b]pyrazine;ethane |
|---|---|
| PubChem CID | 142072078 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3,7-dimethyl-2,7-dihydro-1H-cyclohepta[b]pyrazine;ethane |
| SMILES | CC.CC1=NC2=C(C=CC(C)C=C2)NC1 |
| InChI | InChI=1S/C11H14N2.C2H6/c1-8-3-5-10-11(6-4-8)13-9(2)7-12-10;1-2/h3-6,8,12H,7H2,1-2H3;1-2H3 |
| InChIKey | QKPJSWJNVQXGAC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |