C34H39N3O3S — CID 142072500
ethane;N-[3-[(4-ethylphenoxy)sulfanyloxyamino]-2,3-dihydro-1H-inden-5-yl]-3-phenyl-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 142072500) has the molecular formula C34H39N3O3S and a molecular weight of 569.77 g/mol. Its IUPAC name is ethane;N-[3-[(4-ethylphenoxy)sulfanyloxyamino]-2,3-dihydro-1H-inden-5-yl]-3-phenyl-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | ethane;N-[3-[(4-ethylphenoxy)sulfanyloxyamino]-2,3-dihydro-1H-inden-5-yl]-3-phenyl-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 142072500 |
| Molecular Formula | C34H39N3O3S |
| Molecular Weight | 569.77 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | ethane;N-[3-[(4-ethylphenoxy)sulfanyloxyamino]-2,3-dihydro-1H-inden-5-yl]-3-phenyl-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | CC.CCc1ccc(OSONC2CCc3ccc(N(Cc4cccnc4)C(=O)CCc4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C32H33N3O3S.C2H6/c1-2-24-10-16-29(17-11-24)37-39-38-34-31-18-14-27-13-15-28(21-30(27)31)35(23-26-9-6-20-33-22-26)32(36)19-12-25-7-4-3-5-8-25;1-2/h3-11,13,15-17,20-22,31,34H,2,12,14,18-19,23H2,1H3;1-2H3 |
| InChIKey | ROYFDOFRADGJNK-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.77 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|