C22H23FN4O2 — CID 142073755
N'-[4-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3-oxazol-2-yl]morpholine-4-carboximidamide (PubChem CID 142073755) has the molecular formula C22H23FN4O2 and a molecular weight of 394.45 g/mol. Its IUPAC name is N'-[4-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3-oxazol-2-yl]morpholine-4-carboximidamide.
| Compound Name | N'-[4-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3-oxazol-2-yl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 142073755 |
| Molecular Formula | C22H23FN4O2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N'-[4-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3-oxazol-2-yl]morpholine-4-carboximidamide |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1coc(N=C(N)N2CCOCC2)n1 |
| InChI | InChI=1S/C22H23FN4O2/c1-15(17-7-8-18(19(23)13-17)16-5-3-2-4-6-16)20-14-29-22(25-20)26-21(24)27-9-11-28-12-10-27/h2-8,13-15H,9-12H2,1H3,(H2,24,25,26) |
| InChIKey | NKFMZOKXKCIRQF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|