About 2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene
2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene (PubChem CID 142075081) has the molecular formula C12H20OS
and a molecular weight of 212.36 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene.
Molecular Properties
| Compound Name | 2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene |
| PubChem CID | 142075081 |
| Molecular Formula | C12H20OS |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene |
| SMILES | C=C1SC(C)(CCOCC)C(C)=C1C |
| InChI | InChI=1S/C12H20OS/c1-6-13-8-7-12(5)10(3)9(2)11(4)14-12/h4,6-8H2,1-3,5H3 |
| InChIKey | HPNLHMUGDZFMAQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene?
The IUPAC name of 2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene (CID 142075081) is 2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene.
What is the SMILES notation for 2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene?
The canonical SMILES for 2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene is C=C1SC(C)(CCOCC)C(C)=C1C.
What is the InChIKey of 2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene?
The InChIKey is HPNLHMUGDZFMAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20OS/c1-6-13-8-7-12(5)10(3)9(2)11(4)14-12/h4,6-8H2,1-3,5H3.
What are the key properties of 2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene?
2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene has a molecular weight of 212.36 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxyethyl)-2,3,4-trimethyl-5-methylidenethiophene is sourced from PubChem (CID 142075081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).