About 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene
3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene (PubChem CID 174567378) has the molecular formula C9H16OS
and a molecular weight of 172.29 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene.
Analyze 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene?
The IUPAC name of 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene (CID 174567378) is 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene.
What is the SMILES notation for 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene?
The canonical SMILES for 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene is COCCC1CSC(C)=C1C.
What is the InChIKey of 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene?
The InChIKey is YHDUSEAEYCLBGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OS/c1-7-8(2)11-6-9(7)4-5-10-3/h9H,4-6H2,1-3H3.
What are the key properties of 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene?
3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene has a molecular weight of 172.29 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene is sourced from PubChem (CID 174567378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).