About 3-(2-Methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene
3-(2-Methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene (PubChem CID 174567378) has the molecular formula C9H16OS
and a molecular weight of 172.29 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 3-(2-Methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene |
| PubChem CID | 174567378 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene |
| SMILES | CC1=C(SCC1CCOC)C |
| InChI | InChI=1S/C9H16OS/c1-7-8(2)11-6-9(7)4-5-10-3/h9H,4-6H2,1-3H3 |
| InChIKey | YHDUSEAEYCLBGO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 34.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | 163 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-Methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-Methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene?
The IUPAC name of 3-(2-Methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene (CID 174567378) is 3-(2-methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene.
What is the SMILES notation for 3-(2-Methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene?
The canonical SMILES for 3-(2-Methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene is CC1=C(SCC1CCOC)C.
What is the InChIKey of 3-(2-Methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene?
The InChIKey is YHDUSEAEYCLBGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OS/c1-7-8(2)11-6-9(7)4-5-10-3/h9H,4-6H2,1-3H3.
What are the key properties of 3-(2-Methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene?
3-(2-Methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene has a molecular weight of 172.29 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-Methoxyethyl)-4,5-dimethyl-2,3-dihydrothiophene is sourced from PubChem (CID 174567378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).