C31H49IO3 — CID 142076122
[(5aR,5bR,11aR)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] carboniodidate (PubChem CID 142076122) has the molecular formula C31H49IO3 and a molecular weight of 596.63 g/mol. Its IUPAC name is [(5aR,5bR,11aR)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] carboniodidate.
| Compound Name | [(5aR,5bR,11aR)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] carboniodidate |
|---|---|
| PubChem CID | 142076122 |
| Molecular Formula | C31H49IO3 |
| Molecular Weight | 596.63 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | [(5aR,5bR,11aR)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] carboniodidate |
| SMILES | C=C(C)C1CCC2(CO)CC[C@]3(C)C(CCC4[C@@]5(C)CCC(OC(=O)I)C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C31H49IO3/c1-19(2)20-10-15-31(18-33)17-16-29(6)21(25(20)31)8-9-23-28(5)13-12-24(35-26(32)34)27(3,4)22(28)11-14-30(23,29)7/h20-25,33H,1,8-18H2,2-7H3/t20?,21?,22?,23?,24?,25?,28-,29+,30+,31?/m0/s1 |
| InChIKey | ICEGILUTUIHZCW-RUVHSFMKSA-N |
| XLogP | 8.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.63 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|