C32H51BrO3 — CID 143563742
[(5aR,5bR,9S,11aR)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] 2-bromoacetate (PubChem CID 143563742) has the molecular formula C32H51BrO3 and a molecular weight of 563.66 g/mol. Its IUPAC name is [(5aR,5bR,9S,11aR)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] 2-bromoacetate.
| Compound Name | [(5aR,5bR,9S,11aR)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] 2-bromoacetate |
|---|---|
| PubChem CID | 143563742 |
| Molecular Formula | C32H51BrO3 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | [(5aR,5bR,9S,11aR)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] 2-bromoacetate |
| SMILES | C=C(C)C1CCC2(CO)CC[C@]3(C)C(CCC4[C@@]5(C)CC[C@H](OC(=O)CBr)C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C32H51BrO3/c1-20(2)21-10-15-32(19-34)17-16-30(6)22(27(21)32)8-9-24-29(5)13-12-25(36-26(35)18-33)28(3,4)23(29)11-14-31(24,30)7/h21-25,27,34H,1,8-19H2,2-7H3/t21?,22?,23?,24?,25-,27?,29-,30+,31+,32?/m0/s1 |
| InChIKey | LIZFMLJQXZZACU-ZNKNRECSSA-N |
| XLogP | 7.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|