C23H37N7O6 — CID 142076217
N-[1-[[6-amino-1-[(2-amino-2-oxoethyl)amino]-1-oxohexan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-2-(ethylamino)-5-nitrobenzamide (PubChem CID 142076217) has the molecular formula C23H37N7O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is N-[1-[[6-amino-1-[(2-amino-2-oxoethyl)amino]-1-oxohexan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-2-(ethylamino)-5-nitrobenzamide.
| Compound Name | N-[1-[[6-amino-1-[(2-amino-2-oxoethyl)amino]-1-oxohexan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-2-(ethylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 142076217 |
| Molecular Formula | C23H37N7O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | N-[1-[[6-amino-1-[(2-amino-2-oxoethyl)amino]-1-oxohexan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-2-(ethylamino)-5-nitrobenzamide |
| SMILES | CCNc1ccc([N+](=O)[O-])cc1C(=O)NC(C(=O)NC(CCCCN)C(=O)NCC(N)=O)C(C)CC |
| InChI | InChI=1S/C23H37N7O6/c1-4-14(3)20(23(34)28-18(8-6-7-11-24)22(33)27-13-19(25)31)29-21(32)16-12-15(30(35)36)9-10-17(16)26-5-2/h9-10,12,14,18,20,26H,4-8,11,13,24H2,1-3H3,(H2,25,31)(H,27,33)(H,28,34)(H,29,32) |
| InChIKey | YIOAUKCEHFRKIJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 211.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|