C26H35N3O6 — CID 142076360
methyl 4-[5-[[2-[4-(hydroxyamino)phenyl]acetyl]amino]-2-(3-pyrrolidin-1-ylpropoxy)phenoxy]butanoate (PubChem CID 142076360) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is methyl 4-[5-[[2-[4-(hydroxyamino)phenyl]acetyl]amino]-2-(3-pyrrolidin-1-ylpropoxy)phenoxy]butanoate.
| Compound Name | methyl 4-[5-[[2-[4-(hydroxyamino)phenyl]acetyl]amino]-2-(3-pyrrolidin-1-ylpropoxy)phenoxy]butanoate |
|---|---|
| PubChem CID | 142076360 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | methyl 4-[5-[[2-[4-(hydroxyamino)phenyl]acetyl]amino]-2-(3-pyrrolidin-1-ylpropoxy)phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1cc(NC(=O)Cc2ccc(NO)cc2)ccc1OCCCN1CCCC1 |
| InChI | InChI=1S/C26H35N3O6/c1-33-26(31)6-4-16-35-24-19-22(27-25(30)18-20-7-9-21(28-32)10-8-20)11-12-23(24)34-17-5-15-29-13-2-3-14-29/h7-12,19,28,32H,2-6,13-18H2,1H3,(H,27,30) |
| InChIKey | BQJMHJDABDWGKC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|