C27H35N3O7 — CID 59066546
methyl 4-[5-[[2-(4-nitrophenyl)acetyl]amino]-2-(3-piperidin-1-ylpropoxy)phenoxy]butanoate (PubChem CID 59066546) has the molecular formula C27H35N3O7 and a molecular weight of 513.59 g/mol. Its IUPAC name is methyl 4-[5-[[2-(4-nitrophenyl)acetyl]amino]-2-(3-piperidin-1-ylpropoxy)phenoxy]butanoate.
| Compound Name | methyl 4-[5-[[2-(4-nitrophenyl)acetyl]amino]-2-(3-piperidin-1-ylpropoxy)phenoxy]butanoate |
|---|---|
| PubChem CID | 59066546 |
| Molecular Formula | C27H35N3O7 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | methyl 4-[5-[[2-(4-nitrophenyl)acetyl]amino]-2-(3-piperidin-1-ylpropoxy)phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1cc(NC(=O)Cc2ccc([N+](=O)[O-])cc2)ccc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C27H35N3O7/c1-35-27(32)7-5-17-37-25-20-22(28-26(31)19-21-8-11-23(12-9-21)30(33)34)10-13-24(25)36-18-6-16-29-14-3-2-4-15-29/h8-13,20H,2-7,14-19H2,1H3,(H,28,31) |
| InChIKey | QIKASEIBGUQMSO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|