C18H35N3O3 — CID 142078392
4-ethyl-5-(4-ethylmorpholin-2-yl)-2-(4-ethylmorpholin-3-yl)morpholine (PubChem CID 142078392) has the molecular formula C18H35N3O3 and a molecular weight of 341.50 g/mol. Its IUPAC name is 4-ethyl-5-(4-ethylmorpholin-2-yl)-2-(4-ethylmorpholin-3-yl)morpholine.
| Compound Name | 4-ethyl-5-(4-ethylmorpholin-2-yl)-2-(4-ethylmorpholin-3-yl)morpholine |
|---|---|
| PubChem CID | 142078392 |
| Molecular Formula | C18H35N3O3 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | 4-ethyl-5-(4-ethylmorpholin-2-yl)-2-(4-ethylmorpholin-3-yl)morpholine |
| SMILES | CCN1CCOC(C2COC(C3COCCN3CC)CN2CC)C1 |
| InChI | InChI=1S/C18H35N3O3/c1-4-19-7-10-23-17(11-19)16-14-24-18(12-21(16)6-3)15-13-22-9-8-20(15)5-2/h15-18H,4-14H2,1-3H3 |
| InChIKey | GGPRQINAPMIBLX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |