C16H31NNaO6P — CID 142080817
sodium [4-[decyl(hydroxy)amino]-2,4-dioxobutyl]-ethoxyphosphinate (PubChem CID 142080817) has the molecular formula C16H31NNaO6P and a molecular weight of 387.39 g/mol. Its IUPAC name is sodium [4-[decyl(hydroxy)amino]-2,4-dioxobutyl]-ethoxyphosphinate.
| Compound Name | sodium [4-[decyl(hydroxy)amino]-2,4-dioxobutyl]-ethoxyphosphinate |
|---|---|
| PubChem CID | 142080817 |
| Molecular Formula | C16H31NNaO6P |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | sodium [4-[decyl(hydroxy)amino]-2,4-dioxobutyl]-ethoxyphosphinate |
| SMILES | CCCCCCCCCCN(O)C(=O)CC(=O)CP(=O)([O-])OCC.[Na+] |
| InChI | InChI=1S/C16H32NO6P.Na/c1-3-5-6-7-8-9-10-11-12-17(20)16(19)13-15(18)14-24(21,22)23-4-2;/h20H,3-14H2,1-2H3,(H,21,22);/q;+1/p-1 |
| InChIKey | DMIDYBTYZDZZIO-UHFFFAOYSA-M |
| XLogP | -0.10 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|