C19H38N3O5+ — CID 142081037
7-[[1-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]pyrrolidine-2-carbonyl]amino]heptylazanium (PubChem CID 142081037) has the molecular formula C19H38N3O5+ and a molecular weight of 388.53 g/mol. Its IUPAC name is 7-[[1-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]pyrrolidine-2-carbonyl]amino]heptylazanium.
| Compound Name | 7-[[1-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]pyrrolidine-2-carbonyl]amino]heptylazanium |
|---|---|
| PubChem CID | 142081037 |
| Molecular Formula | C19H38N3O5+ |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 7-[[1-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]pyrrolidine-2-carbonyl]amino]heptylazanium |
| SMILES | COCCOCCOCC(=O)N1CCCC1C(=O)NCCCCCCC[NH3+] |
| InChI | InChI=1S/C19H37N3O5/c1-25-12-13-26-14-15-27-16-18(23)22-11-7-8-17(22)19(24)21-10-6-4-2-3-5-9-20/h17H,2-16,20H2,1H3,(H,21,24)/p+1 |
| InChIKey | SYDDRBDLQHVNSR-UHFFFAOYSA-O |
| XLogP | -0.03 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|