C18H35N2O6PS — CID 157294015
6-[[1-[2-(3-methoxypropylsulfanyl)acetyl]pyrrolidine-2-carbonyl]amino]hexoxy-methylphosphinic acid (PubChem CID 157294015) has the molecular formula C18H35N2O6PS and a molecular weight of 438.53 g/mol. Its IUPAC name is 6-[[1-[2-(3-methoxypropylsulfanyl)acetyl]pyrrolidine-2-carbonyl]amino]hexoxy-methylphosphinic acid.
| Compound Name | 6-[[1-[2-(3-methoxypropylsulfanyl)acetyl]pyrrolidine-2-carbonyl]amino]hexoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 157294015 |
| Molecular Formula | C18H35N2O6PS |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 6-[[1-[2-(3-methoxypropylsulfanyl)acetyl]pyrrolidine-2-carbonyl]amino]hexoxy-methylphosphinic acid |
| SMILES | COCCCSCC(=O)N1CCCC1C(=O)NCCCCCCOP(C)(=O)O |
| InChI | InChI=1S/C18H35N2O6PS/c1-25-12-8-14-28-15-17(21)20-11-7-9-16(20)18(22)19-10-5-3-4-6-13-26-27(2,23)24/h16H,3-15H2,1-2H3,(H,19,22)(H,23,24) |
| InChIKey | CADJGCFMERRKAY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|