C20H40N2O8P2 — CID 171418627
tert-butyl-[4-[[(2S)-1-[6-[hydroxy(methyl)phosphoryl]oxyhexanoyl]pyrrolidine-2-carbonyl]amino]butoxy]phosphinic acid (PubChem CID 171418627) has the molecular formula C20H40N2O8P2 and a molecular weight of 498.49 g/mol. Its IUPAC name is tert-butyl-[4-[[(2S)-1-[6-[hydroxy(methyl)phosphoryl]oxyhexanoyl]pyrrolidine-2-carbonyl]amino]butoxy]phosphinic acid.
| Compound Name | tert-butyl-[4-[[(2S)-1-[6-[hydroxy(methyl)phosphoryl]oxyhexanoyl]pyrrolidine-2-carbonyl]amino]butoxy]phosphinic acid |
|---|---|
| PubChem CID | 171418627 |
| Molecular Formula | C20H40N2O8P2 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | tert-butyl-[4-[[(2S)-1-[6-[hydroxy(methyl)phosphoryl]oxyhexanoyl]pyrrolidine-2-carbonyl]amino]butoxy]phosphinic acid |
| SMILES | CC(C)(C)P(=O)(O)OCCCCNC(=O)[C@@H]1CCCN1C(=O)CCCCCOP(C)(=O)O |
| InChI | InChI=1S/C20H40N2O8P2/c1-20(2,3)32(27,28)30-16-9-7-13-21-19(24)17-11-10-14-22(17)18(23)12-6-5-8-15-29-31(4,25)26/h17H,5-16H2,1-4H3,(H,21,24)(H,25,26)(H,27,28)/t17-/m0/s1 |
| InChIKey | CTGDHLAAJKIFBB-KRWDZBQOSA-N |
| XLogP | 3.27 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|