C22H43N3O2 — CID 155613131
1-[4-[tert-butyl(methyl)amino]butanoyl]-N-(5,5-dimethylhexyl)pyrrolidine-2-carboxamide (PubChem CID 155613131) has the molecular formula C22H43N3O2 and a molecular weight of 381.61 g/mol. Its IUPAC name is 1-[4-[tert-butyl(methyl)amino]butanoyl]-N-(5,5-dimethylhexyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[4-[tert-butyl(methyl)amino]butanoyl]-N-(5,5-dimethylhexyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 155613131 |
| Molecular Formula | C22H43N3O2 |
| Molecular Weight | 381.61 g/mol |
| Exact Mass | 381.34 |
| IUPAC Name | 1-[4-[tert-butyl(methyl)amino]butanoyl]-N-(5,5-dimethylhexyl)pyrrolidine-2-carboxamide |
| SMILES | CN(CCCC(=O)N1CCCC1C(=O)NCCCCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H43N3O2/c1-21(2,3)14-8-9-15-23-20(27)18-12-10-17-25(18)19(26)13-11-16-24(7)22(4,5)6/h18H,8-17H2,1-7H3,(H,23,27) |
| InChIKey | PXTYPDROFZUBFB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|