C24H34S — CID 142081858
10-dodeca-5,7,9,11-tetraen-3-ylsulfanyldodeca-1,3,5,7-tetraene (PubChem CID 142081858) has the molecular formula C24H34S and a molecular weight of 354.60 g/mol. Its IUPAC name is 10-dodeca-5,7,9,11-tetraen-3-ylsulfanyldodeca-1,3,5,7-tetraene.
| Compound Name | 10-dodeca-5,7,9,11-tetraen-3-ylsulfanyldodeca-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 142081858 |
| Molecular Formula | C24H34S |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 10-dodeca-5,7,9,11-tetraen-3-ylsulfanyldodeca-1,3,5,7-tetraene |
| SMILES | C=CC=CC=CC=CCC(CC)SC(CC)CC=CC=CC=CC=C |
| InChI | InChI=1S/C24H34S/c1-5-9-11-13-15-17-19-21-23(7-3)25-24(8-4)22-20-18-16-14-12-10-6-2/h5-6,9-20,23-24H,1-2,7-8,21-22H2,3-4H3 |
| InChIKey | SXISTZFSQOZAJG-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|