C13H13N3O2 — CID 142082412
[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)cyclohepta-1,3,5-trien-1-yl] cyanate (PubChem CID 142082412) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is [4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)cyclohepta-1,3,5-trien-1-yl] cyanate.
| Compound Name | [4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)cyclohepta-1,3,5-trien-1-yl] cyanate |
|---|---|
| PubChem CID | 142082412 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | [4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)cyclohepta-1,3,5-trien-1-yl] cyanate |
| SMILES | CC1CC(=O)NN=C1C1=CC=C(OC#N)CC=C1 |
| InChI | InChI=1S/C13H13N3O2/c1-9-7-12(17)15-16-13(9)10-3-2-4-11(6-5-10)18-8-14/h2-3,5-6,9H,4,7H2,1H3,(H,15,17) |
| InChIKey | NPYVWMRGZNVEHH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|