C12H13N2OY- — CID 159997452
4-methyl-3-(4-methylbenzene-5-id-1-yl)-4,5-dihydro-1H-pyridazin-6-one;yttrium (PubChem CID 159997452) has the molecular formula C12H13N2OY- and a molecular weight of 290.16 g/mol. Its IUPAC name is 4-methyl-3-(4-methylbenzene-5-id-1-yl)-4,5-dihydro-1H-pyridazin-6-one;yttrium.
| Compound Name | 4-methyl-3-(4-methylbenzene-5-id-1-yl)-4,5-dihydro-1H-pyridazin-6-one;yttrium |
|---|---|
| PubChem CID | 159997452 |
| Molecular Formula | C12H13N2OY- |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 4-methyl-3-(4-methylbenzene-5-id-1-yl)-4,5-dihydro-1H-pyridazin-6-one;yttrium |
| SMILES | Cc1[c-]cc(C2=NNC(=O)CC2C)cc1.[Y] |
| InChI | InChI=1S/C12H13N2O.Y/c1-8-3-5-10(6-4-8)12-9(2)7-11(15)13-14-12;/h3,5-6,9H,7H2,1-2H3,(H,13,15);/q-1; |
| InChIKey | CKOIDAGZEGTPII-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|