C9H12N2O — CID 86051160
4-methyl-4a,5,8,8a-tetrahydro-2H-phthalazin-1-one (PubChem CID 86051160) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 4-methyl-4a,5,8,8a-tetrahydro-2H-phthalazin-1-one.
| Compound Name | 4-methyl-4a,5,8,8a-tetrahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 86051160 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 4-methyl-4a,5,8,8a-tetrahydro-2H-phthalazin-1-one |
| SMILES | CC1=NNC(=O)C2CC=CCC12 |
| InChI | InChI=1S/C9H12N2O/c1-6-7-4-2-3-5-8(7)9(12)11-10-6/h2-3,7-8H,4-5H2,1H3,(H,11,12) |
| InChIKey | BUBAPFAYZBOBJT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|