C9H14N2O — CID 98106786
(4S)-4-prop-2-enyl-3-propyl-1,4-dihydropyrazol-5-one (PubChem CID 98106786) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (4S)-4-prop-2-enyl-3-propyl-1,4-dihydropyrazol-5-one.
| Compound Name | (4S)-4-prop-2-enyl-3-propyl-1,4-dihydropyrazol-5-one |
|---|---|
| PubChem CID | 98106786 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (4S)-4-prop-2-enyl-3-propyl-1,4-dihydropyrazol-5-one |
| SMILES | C=CC[C@@H]1C(=O)NN=C1CCC |
| InChI | InChI=1S/C9H14N2O/c1-3-5-7-8(6-4-2)10-11-9(7)12/h3,7H,1,4-6H2,2H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | PWSMRCNUCWFXAH-ZETCQYMHSA-N |
| XLogP | 1.46 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|