C10H14N2O — CID 18732273
2,4-dimethyl-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 18732273) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 2,4-dimethyl-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | 2,4-dimethyl-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 18732273 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2,4-dimethyl-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | CC1=NN(C)C(=O)C2CC=CCC12 |
| InChI | InChI=1S/C10H14N2O/c1-7-8-5-3-4-6-9(8)10(13)12(2)11-7/h3-4,8-9H,5-6H2,1-2H3 |
| InChIKey | BWXRFEIHWBVZGG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|