C10H14N2O — CID 141050915
2-ethyl-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 141050915) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-ethyl-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | 2-ethyl-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 141050915 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-ethyl-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | CCN1N=CC2CC=CCC2C1=O |
| InChI | InChI=1S/C10H14N2O/c1-2-12-10(13)9-6-4-3-5-8(9)7-11-12/h3-4,7-9H,2,5-6H2,1H3 |
| InChIKey | VCAXNSAKJMUPKE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|