C8H10N2O — CID 67503627
(4aR,8aS)-4a,5,8,8a-tetrahydro-2H-phthalazin-1-one (PubChem CID 67503627) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is (4aR,8aS)-4a,5,8,8a-tetrahydro-2H-phthalazin-1-one.
| Compound Name | (4aR,8aS)-4a,5,8,8a-tetrahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 67503627 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (4aR,8aS)-4a,5,8,8a-tetrahydro-2H-phthalazin-1-one |
| SMILES | O=C1NN=C[C@@H]2CC=CC[C@H]12 |
| InChI | InChI=1S/C8H10N2O/c11-8-7-4-2-1-3-6(7)5-9-10-8/h1-2,5-7H,3-4H2,(H,10,11)/t6-,7-/m0/s1 |
| InChIKey | NGZFTPGHJJBJHZ-BQBZGAKWSA-N |
| XLogP | 0.68 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|