C12H14N2O2S — CID 88601390
4-methyl-3-(4-methyl-6-sulfinylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 88601390) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-methyl-3-(4-methyl-6-sulfinylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 4-methyl-3-(4-methyl-6-sulfinylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 88601390 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-methyl-3-(4-methyl-6-sulfinylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CC1=CC(=S=O)C(C2=NNC(=O)CC2C)C=C1 |
| InChI | InChI=1S/C12H14N2O2S/c1-7-3-4-9(10(5-7)17-16)12-8(2)6-11(15)13-14-12/h3-5,8-9H,6H2,1-2H3,(H,13,15) |
| InChIKey | LCMHOMMWRFYYGG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|