C17H18N2O3S — CID 173407694
4-methyl-3-[1-(5-prop-2-ynyl-6-sulfonylcyclohexa-2,4-dien-1-yl)prop-1-en-2-yl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 173407694) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 4-methyl-3-[1-(5-prop-2-ynyl-6-sulfonylcyclohexa-2,4-dien-1-yl)prop-1-en-2-yl]-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 4-methyl-3-[1-(5-prop-2-ynyl-6-sulfonylcyclohexa-2,4-dien-1-yl)prop-1-en-2-yl]-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 173407694 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-methyl-3-[1-(5-prop-2-ynyl-6-sulfonylcyclohexa-2,4-dien-1-yl)prop-1-en-2-yl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | C#CCC1=CC=CC(C=C(C)C2=NNC(=O)CC2C)C1=S(=O)=O |
| InChI | InChI=1S/C17H18N2O3S/c1-4-6-13-7-5-8-14(17(13)23(21)22)9-11(2)16-12(3)10-15(20)18-19-16/h1,5,7-9,12,14H,6,10H2,2-3H3,(H,18,20) |
| InChIKey | QWIVYDVMZCQQCH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|