About N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene
N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene (PubChem CID 142082938) has the molecular formula C17H21BrN2O2
and a molecular weight of 365.27 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene.
Molecular Properties
| Compound Name | N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene |
| PubChem CID | 142082938 |
| Molecular Formula | C17H21BrN2O2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene |
| SMILES | CC(=O)Nc1ccc(Br)cn1.CC(C)=O.Cc1ccccc1 |
| InChI | InChI=1S/C7H7BrN2O.C7H8.C3H6O/c1-5(11)10-7-3-2-6(8)4-9-7;1-7-5-3-2-4-6-7;1-3(2)4/h2-4H,1H3,(H,9,10,11);2-6H,1H3;1-2H3 |
| InChIKey | DXXJYUBGMWJQCF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene?
The IUPAC name of N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene (CID 142082938) is N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene.
What is the SMILES notation for N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene?
The canonical SMILES for N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene is CC(=O)Nc1ccc(Br)cn1.CC(C)=O.Cc1ccccc1.
What is the InChIKey of N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene?
The InChIKey is DXXJYUBGMWJQCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN2O.C7H8.C3H6O/c1-5(11)10-7-3-2-6(8)4-9-7;1-7-5-3-2-4-6-7;1-3(2)4/h2-4H,1H3,(H,9,10,11);2-6H,1H3;1-2H3.
What are the key properties of N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene?
N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene has a molecular weight of 365.27 g/mol, XLogP of 4.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-2-pyridinyl)acetamide;propan-2-one;toluene is sourced from PubChem (CID 142082938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).