C8H11FO2S — CID 142082970
(3E)-5-fluoro-2-methyl-3-methylsulfonylhexa-1,3,5-triene (PubChem CID 142082970) has the molecular formula C8H11FO2S and a molecular weight of 190.24 g/mol. Its IUPAC name is (3E)-5-fluoro-2-methyl-3-methylsulfonylhexa-1,3,5-triene.
| Compound Name | (3E)-5-fluoro-2-methyl-3-methylsulfonylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 142082970 |
| Molecular Formula | C8H11FO2S |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | (3E)-5-fluoro-2-methyl-3-methylsulfonylhexa-1,3,5-triene |
| SMILES | C=C(F)/C=C(\C(=C)C)S(C)(=O)=O |
| InChI | InChI=1S/C8H11FO2S/c1-6(2)8(5-7(3)9)12(4,10)11/h5H,1,3H2,2,4H3/b8-5+ |
| InChIKey | PRDLCYDMWXAGTH-VMPITWQZSA-N |
| XLogP | 1.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|