C28H33ClN4O2 — CID 142083083
N-(5-chloro-2-pyridinyl)-2-[[4-(1-morpholin-4-ylethenyl)anilino]methyl]benzamide;propane (PubChem CID 142083083) has the molecular formula C28H33ClN4O2 and a molecular weight of 493.05 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[4-(1-morpholin-4-ylethenyl)anilino]methyl]benzamide;propane.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[4-(1-morpholin-4-ylethenyl)anilino]methyl]benzamide;propane |
|---|---|
| PubChem CID | 142083083 |
| Molecular Formula | C28H33ClN4O2 |
| Molecular Weight | 493.05 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[4-(1-morpholin-4-ylethenyl)anilino]methyl]benzamide;propane |
| SMILES | C=C(c1ccc(NCc2ccccc2C(=O)Nc2ccc(Cl)cn2)cc1)N1CCOCC1.CCC |
| InChI | InChI=1S/C25H25ClN4O2.C3H8/c1-18(30-12-14-32-15-13-30)19-6-9-22(10-7-19)27-16-20-4-2-3-5-23(20)25(31)29-24-11-8-21(26)17-28-24;1-3-2/h2-11,17,27H,1,12-16H2,(H,28,29,31);3H2,1-2H3 |
| InChIKey | LFNYSKSYDNSQTG-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.05 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |