C10H12N2 — CID 142083391
7-methyl-6,7-dihydroisoquinolin-1-amine (PubChem CID 142083391) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 7-methyl-6,7-dihydroisoquinolin-1-amine.
| Compound Name | 7-methyl-6,7-dihydroisoquinolin-1-amine |
|---|---|
| PubChem CID | 142083391 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 7-methyl-6,7-dihydroisoquinolin-1-amine |
| SMILES | CC1C=c2c(N)nccc2=CC1 |
| InChI | InChI=1S/C10H12N2/c1-7-2-3-8-4-5-12-10(11)9(8)6-7/h3-7H,2H2,1H3,(H2,11,12) |
| InChIKey | SWMSJKMFPJJJKB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |