C26H41NO5S — CID 142083742
(4S,5S,7R,8S,9S,13Z,16S)-16-[(2E,4Z)-4-(ethylideneamino)-5-methylsulfanylpenta-2,4-dien-2-yl]-4,8-dihydroxy-5,7,9-trimethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 142083742) has the molecular formula C26H41NO5S and a molecular weight of 479.68 g/mol. Its IUPAC name is (4S,5S,7R,8S,9S,13Z,16S)-16-[(2E,4Z)-4-(ethylideneamino)-5-methylsulfanylpenta-2,4-dien-2-yl]-4,8-dihydroxy-5,7,9-trimethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,5S,7R,8S,9S,13Z,16S)-16-[(2E,4Z)-4-(ethylideneamino)-5-methylsulfanylpenta-2,4-dien-2-yl]-4,8-dihydroxy-5,7,9-trimethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 142083742 |
| Molecular Formula | C26H41NO5S |
| Molecular Weight | 479.68 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | (4S,5S,7R,8S,9S,13Z,16S)-16-[(2E,4Z)-4-(ethylideneamino)-5-methylsulfanylpenta-2,4-dien-2-yl]-4,8-dihydroxy-5,7,9-trimethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C=N/C(=C\SC)/C=C(\C)[C@@H]1C/C=C\CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)[C@@H](C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C26H41NO5S/c1-7-27-21(16-33-6)14-18(3)23-13-11-9-8-10-12-17(2)25(30)20(5)26(31)19(4)22(28)15-24(29)32-23/h7,9,11,14,16-17,19-20,22-23,25,28,30H,8,10,12-13,15H2,1-6H3/b11-9-,18-14+,21-16-,27-7+/t17-,19-,20+,22-,23-,25-/m0/s1 |
| InChIKey | FHXXYYQASWEDKE-FAJZQWPVSA-N |
| XLogP | 4.86 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|