C26H37NO5S — CID 21456818
(4S,8R,10Z,15S,16S,17S)-4,16-dihydroxy-15,17-dimethyl-8-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-7-oxaspiro[2.15]octadec-10-ene-6,18-dione (PubChem CID 21456818) has the molecular formula C26H37NO5S and a molecular weight of 475.65 g/mol. Its IUPAC name is (4S,8R,10Z,15S,16S,17S)-4,16-dihydroxy-15,17-dimethyl-8-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-7-oxaspiro[2.15]octadec-10-ene-6,18-dione.
| Compound Name | (4S,8R,10Z,15S,16S,17S)-4,16-dihydroxy-15,17-dimethyl-8-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-7-oxaspiro[2.15]octadec-10-ene-6,18-dione |
|---|---|
| PubChem CID | 21456818 |
| Molecular Formula | C26H37NO5S |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (4S,8R,10Z,15S,16S,17S)-4,16-dihydroxy-15,17-dimethyl-8-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-7-oxaspiro[2.15]octadec-10-ene-6,18-dione |
| SMILES | C/C(=C\c1csc(C)n1)[C@H]1C/C=C\CCC[C@H](C)[C@H](O)[C@H](C)C(=O)C2(CC2)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C26H37NO5S/c1-16-9-7-5-6-8-10-21(17(2)13-20-15-33-19(4)27-20)32-23(29)14-22(28)26(11-12-26)25(31)18(3)24(16)30/h6,8,13,15-16,18,21-22,24,28,30H,5,7,9-12,14H2,1-4H3/b8-6-,17-13+/t16-,18-,21+,22-,24-/m0/s1 |
| InChIKey | UEHHDOAVDNVKJY-VVWZUYCVSA-N |
| XLogP | 4.63 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|