C25H35NO5S — CID 71135948
(1R,2S,6S,8Z,13R,14S,15R)-2,14-dihydroxy-1,15-dimethyl-6-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-oxabicyclo[11.3.1]heptadec-8-ene-4,16-dione (PubChem CID 71135948) has the molecular formula C25H35NO5S and a molecular weight of 461.62 g/mol. Its IUPAC name is (1R,2S,6S,8Z,13R,14S,15R)-2,14-dihydroxy-1,15-dimethyl-6-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-oxabicyclo[11.3.1]heptadec-8-ene-4,16-dione.
| Compound Name | (1R,2S,6S,8Z,13R,14S,15R)-2,14-dihydroxy-1,15-dimethyl-6-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-oxabicyclo[11.3.1]heptadec-8-ene-4,16-dione |
|---|---|
| PubChem CID | 71135948 |
| Molecular Formula | C25H35NO5S |
| Molecular Weight | 461.62 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (1R,2S,6S,8Z,13R,14S,15R)-2,14-dihydroxy-1,15-dimethyl-6-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-oxabicyclo[11.3.1]heptadec-8-ene-4,16-dione |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H]1C/C=C\CCC[C@@H]2C[C@@](C)(C(=O)[C@H](C)[C@H]2O)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C25H35NO5S/c1-15(11-19-14-32-17(3)26-19)20-10-8-6-5-7-9-18-13-25(4,21(27)12-22(28)31-20)24(30)16(2)23(18)29/h6,8,11,14,16,18,20-21,23,27,29H,5,7,9-10,12-13H2,1-4H3/b8-6-,15-11+/t16-,18-,20+,21+,23-,25-/m1/s1 |
| InChIKey | MHMJXPRVPZYEDO-DUWIZAJTSA-N |
| XLogP | 4.24 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|